![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 'Government mismanagement'_ Your Morning QP Briefing.pdf | 2018-10-25 13:11 | 43K | |
| 06 09 17 May Jobs Numbers NR 07 om.docx.pdf | 2018-10-25 13:11 | 109K | |
| 09 12 16 SFT NR 06-FORMATTED.docx_5.pdf | 2018-10-25 13:11 | 107K | |
| 09 25 17 College Presidents Retreat - Final Draft - noon Sept 23.pptx.pdf | 2018-10-25 13:11 | 3.4M | |
| 09 25 17 College Presidents Retreat SOC Slide Deck 01 jk.pptx.pdf | 2018-10-25 13:11 | 2.5M | |
| 09 25 17 College Presidents Retreat SOC Slide Deck 02 jk SoC.PPTX.pdf | 2018-10-25 13:11 | 3.2M | |
| 09 25 17 College Presidents Retreat SOC Slide Deck 02 jk SoC.pptx_1.pdf | 2018-10-25 13:11 | 3.2M | |
| 1. MMP Meeting - Agenda - Feb9annotatedv4.docx.pdf | 2018-10-25 13:11 | 85K | |
| 1a. January Fiscal Update_MMMP_Placemat_v4.pdf | 2018-10-25 13:11 | 504K | |
| 2. 20171023 - MMMP (Storyboard and Signature Initiatives) v5_5.pdf | 2018-10-25 13:11 | 562K | |
| 2. 20171023 - MMMP (Storyboard and Signature Initiatives) v5_6.pdf | 2018-10-25 13:11 | 562K | |
| 2. 20171023 - MMMP (Storyboard and Signature Initiatives) v5_7.pdf | 2018-10-25 13:11 | 562K | |
| 3 - MOF - Fiscal Trends_1.pdf | 2018-10-25 13:11 | 1.2M | |
| 3. MMP summary deck v6.pptx.pdf | 2018-10-25 13:11 | 445K | |
| 4 Scalable Initiatives_BPC_updated Mar22 2017.pptx.pdf | 2018-10-25 13:11 | 225K | |
| 5. 2018-19_Wrap-up_presentation-Jan 22 V24.pptx.pdf | 2018-10-25 13:11 | 1.2M | |
| 6. TBS Expense_Feb 8 2017_530pm.pptx.pdf | 2018-10-25 13:11 | 220K | |
| 8. MMP_Q3Finances_Deck_v10.pptx.pdf | 2018-10-25 13:11 | 190K | |
| 12 15 16 SOC Year End Message 05 sf mc jk ks.docx.pdf | 2018-10-25 13:11 | 74K | |
| 20+10 Scenario.pptx_5.pdf | 2018-10-25 13:11 | 149K | |
| 20+10 Scenario.pptx_11.pdf | 2018-10-25 13:12 | 149K | |
| 25% Reduction Timeline One-Pager_Apr10-17.pptx.pdf | 2018-10-25 13:11 | 89K | |
| 2016-12-09 rate mitigation - distributed.pptx_1.pdf | 2018-10-25 13:11 | 375K | |
| 2016 11 19 Hydro One Deferred Tax Asset v03.doc_2.pdf | 2018-10-25 13:11 | 127K | |
| 2016 11 19 Hydro One Deferred Tax Asset v03.pdf | 2018-10-25 13:11 | 20K | |
| 2017-01-25 - BN- ECO GHG Emissions v2 2.docx.pdf | 2018-10-25 13:11 | 277K | |
| 2017-03-08 Consolidated - OFHP Matrix - March 9_v2 ksh.docx_1.pdf | 2018-10-25 13:11 | 108K | |
| 2017-03-13- LTEP Multi-Ministry Update (final)_1.pdf | 2018-10-25 13:11 | 1.4M | |
| 2017-05-30 - LTEP Process Update- Multicorners.pptx_3.pdf | 2018-10-25 13:11 | 143K | |
| 2017-07-12 - PO briefing v2.pptx.pdf | 2018-10-25 13:11 | 426K | |
| 2017-10-19 NR Affordability Fund 20171023 MO PO - CLEAN.DOC.pdf | 2018-10-25 13:11 | 118K | |
| 2017-10-24- LTEP Technical Briefing v9.pdf | 2018-10-25 13:11 | 1.1M | |
| 2017 LTEP News release - 20171025 (final copy).docx.pdf | 2018-10-25 13:11 | 162K | |
| 2017 LTEP Single Backgrounder - 20171025 (with charts, minor edits).docx.pdf | 2018-10-25 13:11 | 1.4M | |
| 20170113 - Premier Wynne Avail at Oakville Chamber of Commerce.docx.pdf | 2018-10-25 13:11 | 69K | |
| 20170524 - QP Briefing.doc.pdf | 2018-10-25 13:11 | 115K | |
| 20170929 FAO Summary Interaction Note_v2.docx.pdf | 2018-10-25 13:11 | 212K | |
| 20171020 FAO Progress Summary Note_v3.docx.pdf | 2018-10-25 13:11 | 218K | |
| 20171109 FAO Progress Summary Note v2.docx.pdf | 2018-10-25 13:11 | 209K | |
| 20171110 - FES Roadshow Presentation V2.pptx.pdf | 2018-10-25 13:11 | 899K | |
| 20171116 FAO Progress Summary Note v4.docx.pdf | 2018-10-25 13:11 | 213K | |
| 20171123 FAO Progress Summary Note v5.docx.pdf | 2018-10-25 13:11 | 237K | |
| 20180220 ADM SNAP Staffing Announcement_3.pdf | 2018-10-25 13:11 | 39K | |
| 23121467-v9-Ontario Fair Hydro Plan Act - Briefing Presentation.pptx_10.pdf | 2018-10-25 13:11 | 137K | |
| 348049791-Cabinet-document_1.pdf | 2018-10-25 13:12 | 490K | |
| AMPCO LTEP Submission_Final_Dec 16 2016_8.pdf | 2018-10-25 13:11 | 482K | |
| A Policy for Lowering Hydro Bills - Feb 21 2017.docx_2.pdf | 2018-10-25 13:11 | 42K | |
| A Policy for Lowering Hydro Bills - Feb 21 2017.docx_3.pdf | 2018-10-25 13:11 | 42K | |
| Accounting Update_SoC_Apr11_Final.pptx.pdf | 2018-10-25 13:11 | 156K | |
| Accounting Update_SoC_Apr11_Final.pptx_1.pdf | 2018-10-25 13:11 | 156K | |
| Accounting Update_SoC_June 2 2017.pptx.pdf | 2018-10-25 13:11 | 199K | |
| Additional Rate Mitigation Proposals_Feb 24.pptx_5.pdf | 2018-10-25 13:11 | 249K | |
| Agenda April 4.docx.pdf | 2018-10-25 13:11 | 59K | |
| Agenda April 4.pdf | 2018-10-25 13:11 | 16K | |
| Agenda October 24.docx.pdf | 2018-10-25 13:11 | 31K | |
| Agenda October 24.docx_1.pdf | 2018-10-25 13:11 | 31K | |
| Agenda SO 05-10-2017.docx.pdf | 2018-10-25 13:11 | 28K | |
| Alykhan Velshi Letter to SoC on AG Request_1.pdf | 2018-10-25 13:11 | 52K | |
| Analysis.pdf | 2018-10-25 13:11 | 187K | |
| April 17.docx_1.pdf | 2018-10-25 13:11 | 163K | |
| April 24.docx_1.pdf | 2018-10-25 13:11 | 185K | |
| April 24.pdf | 2018-10-25 13:11 | 17K | |
| BMO Economics Newsflash_ Ontario Fall Fiscal Update.pdf | 2018-10-25 13:11 | 56K | |
| BN 8 per cent rebate 20160911 v6.docx_3.pdf | 2018-10-25 13:11 | 62K | |
| BN IFHRA 17 April 2017 - v4.docx_1.pdf | 2018-10-25 13:11 | 95K | |
| BOARD_AFG_policy01_energy_playbook_FINAL.pdf | 2018-10-25 13:11 | 2.3M | |
| BOARD_AFG_policy01_energy_playbook_FINAL_1.pdf | 2018-10-25 13:11 | 2.3M | |
| Backgrounder - Electricity - ON-QC Meeting (October 21, 2016).docx_2.pdf | 2018-10-25 13:11 | 52K | |
| Backgrounder - Electricity - ON-QC Meeting (October 21, 2016).docx_3.pdf | 2018-10-25 13:11 | 52K | |
| Briefing FAO on Pension Asset Panel Report.pdf | 2018-10-25 13:11 | 29K | |
| Briefing Note -FHP TPs v4 (2).docx.pdf | 2018-10-25 13:11 | 91K | |
| Briefing Note_ Mtng RE ICI Changes -- March 17.pdf | 2018-10-25 13:11 | 13K | |
| CBN - Electricity Price Mitigation_2.pdf | 2018-10-25 13:11 | 576K | |
| CBN - Electricity Price Protection Feb 27 11pm.docx_1.pdf | 2018-10-25 13:11 | 848K | |
| CO Consult records.pdf | 2018-10-25 13:11 | 104K | |
| CVMA CEO meeting with Premier Wynee.pdf | 2018-10-25 13:11 | 24K | |
| Cabinet Submission - Electricity Price Mitigation-extracts.pdf | 2018-10-25 13:12 | 164K | |
| Cabinet Submission - Electricity Price Mitigation_2.pdf | 2018-10-25 13:11 | 2.7M | |
| Cabinet Submission - Electricity Price Mitigation_9.pdf | 2018-10-25 13:12 | 3.4M | |
| Cabinet Submission - Electricity Price Mitigation_Accounting Diagram.pptx_8.pdf | 2018-10-25 13:11 | 52K | |
| Cabinet Submission - Electricity Price Mitigation_Feb13-17_940_TBS edits.pptx_5.pdf | 2018-10-25 13:12 | 2.1M | |
| Cabinet Submission - Electricity Price Mitigation_Feb17_ Clean _700pm co....pptx_7.pdf | 2018-10-25 13:11 | 2.9M | |
| Cabinet Submission - Electricity Price Mitigation_Feb 22_600_clean.pptx_7.pdf | 2018-10-25 13:11 | 3.7M | |
| Call with DM Imbrogno.pdf | 2018-10-25 13:11 | 23K | |
| Call with DM Rodrigues RE_ Ontario teachers Pension Plan Asset + Labour Update.pdf | 2018-10-25 13:11 | 16K | |
| Canada Pension Plan Reform Script #5 sf edits CLEAN.docx_1.pdf | 2018-10-25 13:11 | 123K | |
| Changes to Global Adjustment.pdf | 2018-10-25 13:11 | 14K | |
| Climate Change - tech briefing + answers QA2a.docx.pdf | 2018-10-25 13:11 | 76K | |
| Climate Change - tech briefing + answers QA2a.pdf | 2018-10-25 13:11 | 19K | |
| Communications Material for October 24, 2017.pdf | 2018-10-25 13:11 | 28K | |
| Communications Material for October 26, 2017.pdf | 2018-10-25 13:11 | 19K | |
| Communications Materials - Friday June, 9th.pdf | 2018-10-25 13:11 | 32K | |
| Communications Materials_ Friday July 21_1.pdf | 2018-10-25 13:11 | 26K | |
| Communications of Policy Change on Feb 18 2014.docx_1.pdf | 2018-10-25 13:11 | 60K | |
| Confidential.pdf | 2018-10-25 13:11 | 28K | |
| Consolidated Cab minute_Feb 17_700.docx_9.pdf | 2018-10-25 13:11 | 87K | |
| Consolidated Cab minute_Feb 17_700.pdf | 2018-10-25 13:11 | 20K | |
| Credit Rating CIN Feb 2018.docx.pdf | 2018-10-25 13:11 | 132K | |
| Credit Rating CIN Feb 2018.docx_1.pdf | 2018-10-25 13:11 | 132K | |
| Credit Rating CIN Feb 2018.docx_2.pdf | 2018-10-25 13:11 | 132K | |
| DAG Memo to DMs - Draft - Oct 21 2017.docx.pdf | 2018-10-25 13:11 | 58K | |
| DMC.pdf | 2018-10-25 13:11 | 14K | |
| DM MEMO re PRB Update v6.doc.pdf | 2018-10-25 13:11 | 96K | |
| DM MN - CCM - 20170314.docx_2.pdf | 2018-10-25 13:11 | 107K | |
| DMs - 2015-16 Financial Statements Uaudited - October 3 2016.docx_1.pdf | 2018-10-25 13:11 | 95K | |
| Dec 12.docx.pdf | 2018-10-25 13:11 | 17K | |
| Dec 12.docx_1.pdf | 2018-10-25 13:11 | 151K | |
| Dec_Order _OESP Charge_f20170323_3.pdf | 2018-10-25 13:11 | 258K | |
| Delivery Line Overview and Options v1.pptx_6.pdf | 2018-10-25 13:11 | 1.2M | |
| Delivery charge one pager.docx_5.pdf | 2018-10-25 13:11 | 59K | |
| Distribution Costs.pdf | 2018-10-25 13:11 | 19K | |
| Document Preservation.pdf | 2018-10-25 13:11 | 66K | |
| Draft FAA reg - September 26 2016_4.pdf | 2018-10-25 13:11 | 83K | |
| Draft Letter to OPT.DOCX_1.pdf | 2018-10-25 13:11 | 46K | |
| Draft report dated May 17, 2017_6.pdf | 2018-10-25 13:11 | 1.0M | |
| Draft report dated May 17, 2017_7.pdf | 2018-10-25 13:11 | 1.0M | |
| Dx Savings Presentation FINAL v2.docx_3.pdf | 2018-10-25 13:11 | 258K | |
| EBO Spring 2018.pdf | 2018-10-25 13:11 | 1.5M | |
| ENERGY BILL INSERTS.docx_2.pdf | 2018-10-25 13:11 | 938K | |
| Electiricity Distrubtion Costs.pdf | 2018-10-25 13:11 | 110K | |
| Electricity 5-Autos May 31 2017 final_2.pdf | 2018-10-25 13:11 | 423K | |
| Electricity 5-Autos May 31 2017 final_3.pdf | 2018-10-25 13:11 | 423K | |
| Electricity Price Mitigation -- LDC Long-term receivable option.docx.pdf | 2018-10-25 13:11 | 245K | |
| Electricity Price Mitigation -- LDC Long-term receivable option.docx_1.pdf | 2018-10-25 13:11 | 248K | |
| Electricity Price Mitigation -- LDC Long-term receivable option.pdf | 2018-10-25 13:11 | 20K | |
| Electricity Relief Scenarios - ESP SNAP CRED (colour coded)_SNAP, ESP, C copy.docx.pdf | 2018-10-25 13:11 | 93K | |
| Embargoed - FAO Economic and Budget Outlook.pdf | 2018-10-25 13:11 | 19K | |
| Energy Emails.pdf | 2018-10-25 13:11 | 17K | |
| Energy FOI Request re FAO.pdf | 2018-10-25 13:11 | 17K | |
| Excerpt from Question Period.pdf | 2018-10-25 13:11 | 42K | |
| FA1710 Combined DFR - V14 Ministry Review-SoC.docx.pdf | 2018-10-25 13:11 | 266K | |
| FAO NEWS ALERT_ Fair Hydro Plan Provides Temporary Electricity Bill Relief But Higher Bills By 2028.pdf | 2018-10-25 13:11 | 73K | |
| FAO NEWS ALERT_ Fair Hydro Plan Provides Temporary Electricity Bill Relief But Higher Bills By 2028_1.pdf | 2018-10-25 13:11 | 37K | |
| FAO Reports.pdf | 2018-10-25 13:11 | 22K | |
| FAO Summary Note _ Week of Nov 20.pdf | 2018-10-25 13:11 | 31K | |
| FAO Summary Note _ Week of November 6.pdf | 2018-10-25 13:11 | 21K | |
| FAO Summary Note _ Week of November 13.pdf | 2018-10-25 13:11 | 24K | |
| FAO report_3.pdf | 2018-10-25 13:11 | 12K | |
| FES 2017 Storyboard Options v.11 FPC.pptx.pdf | 2018-10-25 13:11 | 180K | |
| FHP backgrounder.pdf | 2018-10-25 13:11 | 19K | |
| FPC Materials_1.pdf | 2018-10-25 13:11 | 21K | |
| FWBJA Leg Com Hearings NR final clean.doc_1.pdf | 2018-10-25 13:11 | 110K | |
| FW_ AMPCO - LTEP (CAB)_1.pdf | 2018-10-25 13:11 | 62K | |
| FW_ Accounting Opinions_1.pdf | 2018-10-25 13:11 | 43K | |
| FW_ Accounting Opinions_2.pdf | 2018-10-25 13:11 | 45K | |
| FW_ Accounting risks.pdf | 2018-10-25 13:11 | 18K | |
| FW_ Additional Rate Mitigation Proposals_Feb 24 - Confidential Advice to Cabinet.pdf | 2018-10-25 13:11 | 17K | |
| FW_ Advance Copy of FAO's Nuclear Refurbishment Report.pdf | 2018-10-25 13:11 | 37K | |
| FW_ Bill Inserts_1.pdf | 2018-10-25 13:11 | 34K | |
| FW_ Binnie opinion_4.pdf | 2018-10-25 13:11 | 22K | |
| FW_ CPP Video_1.pdf | 2018-10-25 13:11 | 110K | |
| FW_ Changing Workplace Review - latest communications materials_3.pdf | 2018-10-25 13:11 | 37K | |
| FW_ Comments on ECO report on long term energy plan.pdf | 2018-10-25 13:11 | 14K | |
| FW_ Confidential.pdf | 2018-10-25 13:11 | 30K | |
| FW_ Confidential MMMP materials.pdf | 2018-10-25 13:11 | 43K | |
| FW_ Credit Rating History.pdf | 2018-10-25 13:11 | 54K | |
| FW_ Credit Rating History_1.pdf | 2018-10-25 13:11 | 55K | |
| FW_ Draft FAA Reg re_ 15_16 accounting practices_2.pdf | 2018-10-25 13:11 | 39K | |
| FW_ Draft Ivey Policy Brief.pdf | 2018-10-25 13:11 | 15K | |
| FW_ Draft Ivey Policy Brief on generation costs_3.pdf | 2018-10-25 13:11 | 57K | |
| FW_ Draft Ivey Policy Brief on generation costs_4.pdf | 2018-10-25 13:11 | 51K | |
| FW_ Draft op-ed_1.pdf | 2018-10-25 13:11 | 50K | |
| FW_ Draft op-ed_2.pdf | 2018-10-25 13:11 | 49K | |
| FW_ Electricity Assessment note.pdf | 2018-10-25 13:11 | 11K | |
| FW_ Electricity bill timing.pdf | 2018-10-25 13:11 | 61K | |
| FW_ Embargoed_ Long-Term Budget Outlook.pdf | 2018-10-25 13:11 | 25K | |
| FW_ Energy Centre Newsletter_1.pdf | 2018-10-25 13:11 | 68K | |
| FW_ Executive Staffing Announcement, ADM, SNAP_1.pdf | 2018-10-25 13:11 | 70K | |
| FW_ FAO Reports.pdf | 2018-10-25 13:11 | 46K | |
| FW_ FAO report_1.pdf | 2018-10-25 13:11 | 34K | |
| FW_ Financial Accountability Office _ Tracker.pdf | 2018-10-25 13:11 | 25K | |
| FW_ Following-up_ Petition for the _10 year pension credit_ Eligibility of _Post Retirement insurance Benefits_ for OPS employees hired between 1_1_2007 and 18_2_2014.pdf | 2018-10-25 13:11 | 151K | |
| FW_ Follow up information_2.pdf | 2018-10-25 13:11 | 47K | |
| FW_ GA Financing Legal Advice_3.pdf | 2018-10-25 13:11 | 17K | |
| FW_ GA Smoothing -- brief update_1.pdf | 2018-10-25 13:11 | 32K | |
| FW_ Infomart_ FAO expects Ontario budget to remain in deficit without... - Canada Newswire.pdf | 2018-10-25 13:11 | 39K | |
| FW_ Joint Meeting _ AG Report_1.pdf | 2018-10-25 13:11 | 50K | |
| FW_ LTEP_OFHP briefing.pdf | 2018-10-25 13:11 | 22K | |
| FW_ Letter_1.pdf | 2018-10-25 13:11 | 18K | |
| FW_ MATERIALS_ Budget Prep Committee Meeting, February 22 (10_00am - 11_30am).pdf | 2018-10-25 13:11 | 60K | |
| FW_ Major Projects Committee-Proposed Approach.pdf | 2018-10-25 13:11 | 43K | |
| FW_ Media Advisory - Current draft.pdf | 2018-10-25 13:11 | 12K | |
| FW_ Minute - Feb. 27th_1.pdf | 2018-10-25 13:11 | 42K | |
| FW_ OPG Analysis.pdf | 2018-10-25 13:11 | 15K | |
| FW_ OPG GA Sensitivity Analysis_1.pdf | 2018-10-25 13:11 | 44K | |
| FW_ OPG White Paper - GAC deferral_1.pdf | 2018-10-25 13:11 | 68K | |
| FW_ OPG analysis of hydrogen opportunities in transportation_ Next Hydrogen.pdf | 2018-10-25 13:11 | 39K | |
| FW_ OrsiniLetter.pdf | 2018-10-25 13:11 | 55K | |
| FW_ Petition for the _10 year pension credit_ Eligibility of _Post Retirement insurance Benefits_ for OPS employees hired between 1_1_2007 and 18_2_2014.pdf | 2018-10-25 13:11 | 122K | |
| FW_ Potential Rate Mitigation_4.pdf | 2018-10-25 13:11 | 37K | |
| FW_ Price Mitigation Proposals_Nov24-16-v3.pptx - Confidential Advice to Cabinet - Rough Draft.pdf | 2018-10-25 13:11 | 22K | |
| FW_ Proposed Initiatives to Transform Ontario's Electricity Sector_Dec9-16_v15 copy.pptx_1.pdf | 2018-10-25 13:11 | 15K | |
| FW_ Rate Mitigation -OEB + IESO_1.pdf | 2018-10-25 13:11 | 15K | |
| FW_ Rate Mitigation -OEB + IESO_2.pdf | 2018-10-25 13:11 | 15K | |
| FW_ Rate Mitigation Update_1.pdf | 2018-10-25 13:11 | 16K | |
| FW_ Removal of OESP charge_1.pdf | 2018-10-25 13:11 | 18K | |
| FW_ Revised letters.pdf | 2018-10-25 13:11 | 27K | |
| FW_ SoC Comms Products for University of Waterloo visit (Nov. 24).pdf | 2018-10-25 13:11 | 38K | |
| FW_ TBS question re ITA Excess Surplus.pdf | 2018-10-25 13:11 | 56K | |
| FW_ TS_ Final English Media Materials_2.pdf | 2018-10-25 13:11 | 62K | |
| FW_ TS_ Final English Media Materials_3.pdf | 2018-10-25 13:11 | 59K | |
| FW_ Technical Briefing deck_6.pdf | 2018-10-25 13:11 | 15K | |
| FW_ Teleconference Call on Document Disclosure _ Secretary Orsini, DM Glasberg, DM Imbrogno, DM Thompson, DM Davidson, DM Betzner.pdf | 2018-10-25 13:11 | 39K | |
| FW_ Transcript_ Premier Wynne's Avail at the Oakville Chamber of Commerce.pdf | 2018-10-25 13:11 | 66K | |
| FW_ URGENT_ Material - Cabinet - March 1, 2017.pdf | 2018-10-25 13:11 | 56K | |
| FYI_ Agenda included_ Long-Term Energy Plan Multi-Ministry Meeting.pdf | 2018-10-25 13:11 | 46K | |
| FYI_] Patrick Brown to Minister Sandals - March 17, 2017.pdf | 2018-10-25 13:11 | 228K | |
| Fair Adjustment Excerpt_1.pdf | 2018-10-25 13:11 | 19K | |
| Fair Adjustment excerpt.docx_4.pdf | 2018-10-25 13:11 | 91K | |
| Fair Hydro Plan_6.pdf | 2018-10-25 13:11 | 676K | |
| Fair Hydro Plan_7.pdf | 2018-10-25 13:11 | 676K | |
| Fair Hydro Report_FINAL.PDF_2.pdf | 2018-10-25 13:11 | 835K | |
| Fair Hydro Report_FINAL.PDF_3.pdf | 2018-10-25 13:11 | 835K | |
| Fair Hydro Update.pdf | 2018-10-25 13:11 | 34K | |
| February Fiscal Strategy_MMP_vfinal.pptx.pdf | 2018-10-25 13:11 | 863K | |
| February Fiscal Strategy_MMP_vfinal.pptx_1.pdf | 2018-10-25 13:11 | 863K | |
| Final LTR to Patrick Monahan re Global Adjustment Feb 27 2017_7643647_5.pdf | 2018-10-25 13:11 | 354K | |
| Fiscal Overview.pptx.pdf | 2018-10-25 13:11 | 89K | |
| Fiscal Policy Framework Deck_v22.pptx.pdf | 2018-10-25 13:11 | 451K | |
| Fiscal Policy Framework Deck_v22.pptx_1.pdf | 2018-10-25 13:11 | 451K | |
| Fiscal Thought Experiments.pptx.pdf | 2018-10-25 13:11 | 30K | |
| Fw_ Changing Workplace Review - latest communications materials_2.pdf | 2018-10-25 13:11 | 35K | |
| Fw_ Commentators_ Auditor general gets called out for a bad call - Toronto Star.pdf | 2018-10-25 13:11 | 45K | |
| Fw_ Communications Materials for June 22.pdf | 2018-10-25 13:11 | 31K | |
| Fw_ Document Preservation.pdf | 2018-10-25 13:11 | 83K | |
| Fw_ Energy minute.pdf | 2018-10-25 13:11 | 30K | |
| Fw_ Estimates_1.pdf | 2018-10-25 13:11 | 45K | |
| Fw_ FPC this week_2.pdf | 2018-10-25 13:11 | 20K | |
| Fw_ Global Adjustment Deck.pdf | 2018-10-25 13:11 | 19K | |
| Fw_ Letter from the Honourable Liz Sandals, President of the Treasury Board to Smokey Thomas.pdf | 2018-10-25 13:11 | 15K | |
| Fw_ MMMP e-Binder_1.pdf | 2018-10-25 13:11 | 21K | |
| Fw_ Memorandum from Andrew Bevan regarding Records Retention.pdf | 2018-10-25 13:11 | 18K | |
| Fw_ New Energy File - Initial thoughts.pdf | 2018-10-25 13:11 | 32K | |
| Fw_ Next Round Hydro Quebec_2.pdf | 2018-10-25 13:11 | 56K | |
| Fw_ ON-QC Joint Cabinet Meeting - Outcomes and Next Steps Memos from SoC.pdf | 2018-10-25 13:11 | 37K | |
| Fw_ PC Leader Ford promises _outside audit_ of all government spending on his first day in office_1.pdf | 2018-10-25 13:11 | 39K | |
| Fw_ Post retirement benefits.pdf | 2018-10-25 13:11 | 67K | |
| Fw_ Public Accounts Technical Briefing 201617_Sept 1_Draft_v3.pptx.pdf | 2018-10-25 13:11 | 22K | |
| Fw_ Public Service_ Billions at stake in accounting dispute - Toronto Star.pdf | 2018-10-25 13:11 | 45K | |
| Fw_ QP Briefing_ May 24, 2017.pdf | 2018-10-25 13:11 | 123K | |
| Fw_ Reduction Timeline_1.pdf | 2018-10-25 13:11 | 20K | |
| Fw_ Smoothing chart_2.pdf | 2018-10-25 13:11 | 19K | |
| Fwd_ CVMA CEO meeting with Premier Wynee.pdf | 2018-10-25 13:11 | 26K | |
| Fwd_ GA Smoothing -- brief update.pdf | 2018-10-25 13:11 | 32K | |
| Fwd_ LTEP Technical Deck_1.pdf | 2018-10-25 13:11 | 18K | |
| Fwd_ Media Event_ FAO Economic and Fiscal Outlook Report.pdf | 2018-10-25 13:11 | 71K | |
| Fwd_ Options.pdf | 2018-10-25 13:11 | 12K | |
| Fwd_ Release of 2015 - 2016 Financial Statements (Unaudited).pdf | 2018-10-25 13:11 | 66K | |
| Fwd_ Revised report.pdf | 2018-10-25 13:11 | 52K | |
| Fwd_ Update Confidential Advice to Cabinet.pdf | 2018-10-25 13:11 | 38K | |
| GA Consolidated Memo_May 17 FINAL.PDF_4.pdf | 2018-10-25 13:11 | 302K | |
| GA Consolidated Memo_May 17 FINAL.PDF_5.pdf | 2018-10-25 13:11 | 302K | |
| GA Deferral - Confidential Commercially Sensitive Information.pdf | 2018-10-25 13:11 | 19K | |
| GA Deferral.pdf | 2018-10-25 13:11 | 33K | |
| GA Financing Opinion - Feb 10 - Confidential Solicitor-Client Privilege.pdf | 2018-10-25 13:11 | 19K | |
| GA Financing Opinion - Feb 10.docx_3.pdf | 2018-10-25 13:11 | 313K | |
| GA Smoothing Sensitivities 2017-02-24_7.pdf | 2018-10-25 13:11 | 1.0M | |
| Global Adjustment Deferral - White Paper - Terms to MOE Feb 21_2017_5.pdf | 2018-10-25 13:11 | 260K | |
| Global Adjustment Deferral_White Paper_OPG r1a_5.pdf | 2018-10-25 13:11 | 864K | |
| Happy byelection day!_ Your Morning QP Briefing.pdf | 2018-10-25 13:11 | 42K | |
| Hydro-leaks_ Your Afternoon QP Briefing_1.pdf | 2018-10-25 13:11 | 41K | |
| Hydro scheme skewered_ Your Afternoon Briefing.pdf | 2018-10-25 13:11 | 37K | |
| Independent Accounting Experts Release Report_2.pdf | 2018-10-25 13:11 | 32K | |
| Independent Accounting Experts Release Report_3.pdf | 2018-10-25 13:11 | 40K | |
| Information _ Financial Accountability Office _ Tracker.pdf | 2018-10-25 13:11 | 17K | |
| Issues Mgmt Plan - FAO Report Nuclear Refurb.ppt.pdf | 2018-10-25 13:11 | 107K | |
| Ivey - Ontario Electricity Pricing - April 19 2017.pdf | 2018-10-25 13:11 | 2.1M | |
| IveyEnergyCentre_ElectricityOntario_March7v3 - SoC Comments.pdf | 2018-10-25 13:11 | 3.1M | |
| IveyEnergyCentre_ElectricityOntario_March7v3[1]_2.pdf | 2018-10-25 13:11 | 2.5M | |
| IveyEnergyCentre_ElectricityOntario_March7v3[1]_3.pdf | 2018-10-25 13:11 | 2.5M | |
| Jan 9.docx.pdf | 2018-10-25 13:11 | 17K | |
| Jan 9.docx_1.pdf | 2018-10-25 13:11 | 166K | |
| June 6.docx.pdf | 2018-10-25 13:11 | 63K | |
| June 6.pdf | 2018-10-25 13:11 | 12K | |
| June 13.docx.pdf | 2018-10-25 13:11 | 59K | |
| June 27.docx.pdf | 2018-10-25 13:11 | 55K | |
| June 27.docx_1.pdf | 2018-10-25 13:11 | 55K | |
| KM-QA.DOCX_4.pdf | 2018-10-25 13:11 | 175K | |
| Key Considerations associated with the GA proposal.docx.pdf | 2018-10-25 13:11 | 73K | |
| Key Considerations associated with the GA proposal.docx_1.pdf | 2018-10-25 13:11 | 60K | |
| Key Considerations associated with the GA proposalv3.docx.pdf | 2018-10-25 13:11 | 86K | |
| Key Considerations associated with the GA proposalv3.pdf | 2018-10-25 13:11 | 17K | |
| Key Point.pdf | 2018-10-25 13:11 | 22K | |
| LTEFO 2017 EN.PDF_1.pdf | 2018-10-25 13:11 | 2.3M | |
| LTEP Submission_1.pdf | 2018-10-25 13:11 | 32K | |
| LTEP_1.pdf | 2018-10-25 13:11 | 18K | |
| Latest Energy Relief Deck.pdf | 2018-10-25 13:11 | 14K | |
| Ltr to Minister re Fair Hydro Plan_May 17 2017_6.pdf | 2018-10-25 13:11 | 513K | |
| Ltr to Minister re Fair Hydro Plan_May 17 2017_7.pdf | 2018-10-25 13:11 | 513K | |
| MATERIALS_ SoC_DM Angus 1_1 (Nov. 25).pdf | 2018-10-25 13:11 | 41K | |
| MC-2018-423 Outgoing.pdf | 2018-10-25 13:11 | 83K | |
| MC-2018-423 Outgoing_1.pdf | 2018-10-25 13:11 | 83K | |
| MMMP Deck - Scalable Options.pdf | 2018-10-25 13:11 | 18K | |
| MMMP Electronic Binder.pdf | 2018-10-25 13:11 | 17K | |
| MMP summary deckv5 (2).pptx.pdf | 2018-10-25 13:11 | 444K | |
| MN - SOC meets Stonemill Bakehouse on March 10 - ENERGY - 2017-03-09.docx.pdf | 2018-10-25 13:11 | 94K | |
| MN - SOC meets Stonemill Bakehouse on March 10 - ENERGY - 2017-03-09.docx_1.pdf | 2018-10-25 13:11 | 94K | |
| Major Projects Committee-Proposed Approach.pdf | 2018-10-25 13:11 | 42K | |
| Making Connections_Webinar_ Apr 17 FINAL.pdf | 2018-10-25 13:11 | 2.9M | |
| March 21.docx.pdf | 2018-10-25 13:11 | 55K | |
| March 21.pdf | 2018-10-25 13:11 | 18K | |
| March 27.docx.pdf | 2018-10-25 13:11 | 159K | |
| May 30.docx.pdf | 2018-10-25 13:11 | 61K | |
| May 30.pdf | 2018-10-25 13:11 | 12K | |
| Media Scan_ Amazon - February 7, 2018.pdf | 2018-10-25 13:11 | 31K | |
| Memo from Minister Sandals to OPSEU President_Feb 17_2017.doc_1.pdf | 2018-10-25 13:11 | 75K | |
| Microsoft_Excel_Worksheet11.xlsx_12.pdf | 2018-10-25 13:11 | 13K | |
| Microsoft_Excel_Worksheet11.xlsx_13.pdf | 2018-10-25 13:11 | 13K | |
![[ ]](/icons/unknown.gif) | Microsoft_Excel_Worksheet11_12.xlsx | 2018-10-25 11:08 | 9.7K | |
| Microsoft_Excel_Worksheet11_13.xlsx | 2018-10-25 11:08 | 9.7K | |
| Microsoft_Word_Document2.docx.pdf | 2018-10-25 13:11 | 73K | |
| Minister Sandals and President Thomas Letter - January 4 2018_1.pdf | 2018-10-25 13:11 | 1.5M | |
| Nov 21.docx.pdf | 2018-10-25 13:11 | 54K | |
| OB Note- FAO Updated Summary 30 8 2017.docx.pdf | 2018-10-25 13:11 | 178K | |
| OB Note- FAO Updated Summary 30 8 2017.docx_1.pdf | 2018-10-25 13:11 | 178K | |
| OEB - RPP Backgrounder.pdf | 2018-10-25 13:11 | 171K | |
| OEB - RPP News Release.pdf | 2018-10-25 13:11 | 112K | |
| OEB - RPP Presentation.pdf | 2018-10-25 13:11 | 283K | |
| OFHP - Media Briefing-Feb28_931-Comments.pptx_3.pdf | 2018-10-25 13:11 | 762K | |
| OFHP - Media Briefing-Mar1_800.pptx_25.pdf | 2018-10-25 13:11 | 548K | |
| OFHP Gov and Delievery Structure - March 9.docx_1.pdf | 2018-10-25 13:11 | 65K | |
| OFHP Technical Briefing Deck Outline.docx.pdf | 2018-10-25 13:11 | 62K | |
| ON-QC Joint Cabinet Meeting - Outcomes and Next Steps Memos from SoC.pdf | 2018-10-25 13:11 | 25K | |
| OPG Letter -Tracked_edit-May 12-JGM JR.PDF_4.pdf | 2018-10-25 13:11 | 99K | |
| OPG Letter -Tracked_edit-May 12-JGM JR.PDF_5.pdf | 2018-10-25 13:11 | 99K | |
| OPSEU_Asset_ceiling_document_Final.pdf | 2018-10-25 13:11 | 298K | |
| OPTrust_1.pdf | 2018-10-25 13:11 | 47K | |
| OPTrust_2.pdf | 2018-10-25 13:11 | 17K | |
| OTPP Pension Returns - Sept 2016.pdf | 2018-10-25 13:11 | 130K | |
| OTPP_Asset_ceiling_document_Final.pdf | 2018-10-25 13:11 | 368K | |
| Oct. 19 - Brown Accountability 2.doc_1.pdf | 2018-10-25 13:11 | 91K | |
| October 17.docx_4.pdf | 2018-10-25 13:12 | 61K | |
| October 17v2.docx.pdf | 2018-10-25 13:11 | 61K | |
| October 24.docx.pdf | 2018-10-25 13:11 | 55K | |
| Ontario's Fiscal Challenges.pdf | 2018-10-25 13:11 | 13K | |
| Ontario Creating Fair Workplaces and Better Jobs_2.pdf | 2018-10-25 13:11 | 56K | |
| Ontario Cutting Electricity Bills by 25 Per Cent_5.pdf | 2018-10-25 13:11 | 57K | |
| Ontario Cutting Electricity Bills by 25 Per Cent_6.pdf | 2018-10-25 13:11 | 59K | |
| Ontario Fiscal.docx.pdf | 2018-10-25 13:11 | 54K | |
| Ontario Helping Businesses Save Time and Money_3.pdf | 2018-10-25 13:11 | 59K | |
| OrsiniLetter_3.pdf | 2018-10-25 13:11 | 61K | |
| PA15_MediaProductsNoOpinionwReg0110 (BS post meeting #3)-Comments.docx.pdf | 2018-10-25 13:11 | 414K | |
| PA15_MediaProductsNoOpinionwReg0110 (BS post meeting #3)-Comments.pdf | 2018-10-25 13:11 | 21K | |
| PA 2016-17_Media Advisory_v1_CO2 bb.doc.pdf | 2018-10-25 13:11 | 100K | |
| PAEAP- Supplemental Report FINAL (2).pdf | 2018-10-25 13:11 | 372K | |
| PCs Request for Record Retention - October 21 2017 - Draft.docx.pdf | 2018-10-25 13:11 | 115K | |
| PCs Request for Record Retention - October 21 2017 - Draft.docx_1.pdf | 2018-10-25 13:11 | 115K | |
| PCs Request for Record Retention - October 23 2017 - Draft.docx.pdf | 2018-10-25 13:11 | 127K | |
| PCs Request for Record Retention - October 23 2017 - Draft.docx_1.pdf | 2018-10-25 13:11 | 127K | |
| P Weekly.pdf | 2018-10-25 13:11 | 13K | |
| Patrick Brown.docx_1.pdf | 2018-10-25 13:12 | 56K | |
| Pension Asset Description.pdf | 2018-10-25 13:11 | 15K | |
| Pension Asset Expert Advisory Panel Submits Report_3.pdf | 2018-10-25 13:11 | 59K | |
| Pension Panel Slides _2016-17 PA Tech Briefing_Final.pptx_1.pdf | 2018-10-25 13:11 | 67K | |
| Pension plan perestroika_ Your Morning QP Briefing_1.pdf | 2018-10-25 13:11 | 43K | |
| Post-Retirement-Insurance Benefits 10-years Eligibility Petition group s.pdf | 2018-10-25 13:11 | 44K | |
| Post-Retirement-Insurance Benefits 10-years Eligibility Petition group s_1.pdf | 2018-10-25 13:11 | 44K | |
| Premier's Statement on Ontario's Fair Hydro Plan_1.pdf | 2018-10-25 13:11 | 71K | |
| Presentation to College President's on Monday.pdf | 2018-10-25 13:11 | 20K | |
| Price Mitigation Proposals_Dec5-16_v11.pptx_7.pdf | 2018-10-25 13:11 | 637K | |
| Price Mitigation Proposals_Nov24-16-v3.pptx_5.pdf | 2018-10-25 13:11 | 563K | |
| Proposed Initiatives to Transform Ontario's Electricity Sector_Dec9-16_v15 copy.pptx_6.pdf | 2018-10-25 13:11 | 138K | |
| Public Accounts.pdf | 2018-10-25 13:11 | 18K | |
| Public Accounts Technical Briefing 201617_Final.pptx_1.pdf | 2018-10-25 13:11 | 242K | |
| Public Accounts Technical Briefing 201617_Sept 1_Draft_v3.pptx.pdf | 2018-10-25 13:11 | 223K | |
| Quebec Deal analysis_Aug31_17_3.pdf | 2018-10-25 13:11 | 450K | |
| RAN Electricity Price Mitigation v8 2017 02 28.doc_5.pdf | 2018-10-25 13:11 | 1.3M | |
| RE_ Additional Rate Mitigation Proposals_Feb 24 - Confidential Advice to Cabinet.pdf | 2018-10-25 13:11 | 17K | |
| RE_ Agenda for Weekly.pdf | 2018-10-25 13:11 | 19K | |
| RE_ CBN - Electricity Price Protection Feb 28 - Confidential Advice for Cabinet.pdf | 2018-10-25 13:11 | 38K | |
| RE_ Central Agency DM weekly agenda (January 9).pdf | 2018-10-25 13:11 | 41K | |
| RE_ Credit Rating History.pdf | 2018-10-25 13:11 | 54K | |
| RE_ Delivery charges question.pdf | 2018-10-25 13:11 | 46K | |
| RE_ Energy note_minute_1.pdf | 2018-10-25 13:11 | 25K | |
| RE_ FAO's Fall 2017 EFO.pdf | 2018-10-25 13:11 | 51K | |
| RE_ FAO Initial Report on OFHP_2.pdf | 2018-10-25 13:11 | 15K | |
| RE_ FHP backgrounder_1.pdf | 2018-10-25 13:11 | 31K | |
| RE_ Fes Deck.pdf | 2018-10-25 13:11 | 36K | |
| RE_ Formatted Letters_1.pdf | 2018-10-25 13:11 | 24K | |
| RE_ G&M Article - Corrections.pdf | 2018-10-25 13:11 | 38K | |
| RE_ Globe & Mail Story re FHP Accounting_2.pdf | 2018-10-25 13:11 | 130K | |
| RE_ Inaccurate Chart_2.pdf | 2018-10-25 13:11 | 51K | |
| RE_ LTEP Submission_1.pdf | 2018-10-25 13:11 | 46K | |
| RE_ Legal Issues - Public Accounts.pdf | 2018-10-25 13:11 | 45K | |
| RE_ Media Issue.pdf | 2018-10-25 13:11 | 47K | |
| RE_ Minute and note - Feb. 27th.pdf | 2018-10-25 13:11 | 41K | |
| RE_ New FOI Request - CO_PO 18-24 - Letter to SoC re Fair Hydro Records_1.pdf | 2018-10-25 13:11 | 20K | |
| RE_ OPG GA Sensitivity Analysis.pdf | 2018-10-25 13:11 | 57K | |
| RE_ OPG White Paper - GAC deferral.pdf | 2018-10-25 13:11 | 74K | |
| RE_ OPTrust report.pdf | 2018-10-25 13:11 | 34K | |
| RE_ OrsiniLetter_1.pdf | 2018-10-25 13:11 | 70K | |
| RE_ OrsiniLetter_2.pdf | 2018-10-25 13:11 | 39K | |
| RE_ Pension accounting-FAO.pdf | 2018-10-25 13:11 | 42K | |
| RE_ Presentation to Colleges next week.pdf | 2018-10-25 13:11 | 46K | |
| RE_ QP Briefing_ May 24, 2017.pdf | 2018-10-25 13:11 | 118K | |
| RE_ Rate Mitigation Cab Sub and Minute_2.pdf | 2018-10-25 13:11 | 15K | |
| RE_ Rate Mitigation Modelling.pdf | 2018-10-25 13:11 | 14K | |
| RE_ Rate Mitigation Plan Options_Feb 1 - Confidential Advice to Cabinet.pdf | 2018-10-25 13:11 | 44K | |
| RE_ Rate Mitigation Table.pdf | 2018-10-25 13:11 | 14K | |
| RE_ Rate Mitigation Table_1.pdf | 2018-10-25 13:11 | 14K | |
| RE_ Rate Mitigation_40.pdf | 2018-10-25 13:11 | 15K | |
| RE_ Rate Mitigation_41.pdf | 2018-10-25 13:11 | 39K | |
| RE_ Rate Mitigation_42.pdf | 2018-10-25 13:11 | 13K | |
| RE_ Rate mitigation_43.pdf | 2018-10-25 13:11 | 14K | |
| RE_ Release of 2015 - 2016 Financial Statements (Unaudited)_1.pdf | 2018-10-25 13:11 | 67K | |
| RE_ Thank you.pdf | 2018-10-25 13:11 | 27K | |
| RE_ The Fair Hydro Plan_1.pdf | 2018-10-25 13:11 | 36K | |
| RE_ Tomorrow - touch base with Ed Clark.pdf | 2018-10-25 13:11 | 42K | |
| RE_ Weekly Agenda April 17.pdf | 2018-10-25 13:11 | 27K | |
| RE_ Weekly Agenda_1.pdf | 2018-10-25 13:11 | 23K | |
| RE_ Weekly Agenda for your review.pdf | 2018-10-25 13:11 | 46K | |
| RE_ Weekly agenda.pdf | 2018-10-25 13:11 | 28K | |
| RE__11.pdf | 2018-10-25 13:11 | 41K | |
| RE_ _no subject_.pdf | 2018-10-25 13:11 | 24K | |
| RE_ coalition members hydro bill.pdf | 2018-10-25 13:11 | 15K | |
| RE_ one pager_1.pdf | 2018-10-25 13:11 | 36K | |
| RPP July 1 Min Statement 2017-06-20 PO.DOCX_1.pdf | 2018-10-25 13:11 | 102K | |
| Rate Mitigation Measures_December 9 2016 v2_3.pdf | 2018-10-25 13:11 | 727K | |
| Rate Mitigation Measures_December 9 2016 v2_4.pdf | 2018-10-25 13:11 | 727K | |
| Rate Mitigation Measures_December 9 2016 v3_7.pdf | 2018-10-25 13:11 | 707K | |
| Rate Mitigation Plan Options 20170124__Clean1.pptx_5.pdf | 2018-10-25 13:11 | 1.8M | |
| Rate Mitigation Plan Options_Feb 1 - Confidential Advice to Cabinet.pdf | 2018-10-25 13:11 | 21K | |
| Rate Mitigation Plan Options_Feb 9 version _1230.pptx_13.pdf | 2018-10-25 13:11 | 1.4M | |
| Rate Mitigation Plan Options_Feb 9 version _1230.pptx_14.pdf | 2018-10-25 13:11 | 1.4M | |
| Rate Mitigation Plan Options_Feb 9 version _1230.pptx_33.pdf | 2018-10-25 13:12 | 1.4M | |
| Re_ AG call this aft_1.pdf | 2018-10-25 13:11 | 41K | |
| Re_ Delivery charges question_1.pdf | 2018-10-25 13:11 | 53K | |
| Re_ Electricity bill timing_2.pdf | 2018-10-25 13:11 | 63K | |
| Re_ Electricity bill timing_3.pdf | 2018-10-25 13:11 | 67K | |
| Re_ Fair Hydro Plan_7.pdf | 2018-10-25 13:11 | 30K | |
| Re_ Formatted Letters.pdf | 2018-10-25 13:11 | 31K | |
| Re_ GA Deferral.pdf | 2018-10-25 13:11 | 15K | |
| Re_ GA Smoothing -- brief update.pdf | 2018-10-25 13:11 | 35K | |
| Re_ Letter.pdf | 2018-10-25 13:11 | 20K | |
| Re_ OPTrust report_1.pdf | 2018-10-25 13:11 | 16K | |
| Re_ OrsiniLetter.pdf | 2018-10-25 13:11 | 76K | |
| Re_ PLEASE READ_ Phone call today - DM Imbrogno and SoC - 3_30.pdf | 2018-10-25 13:11 | 25K | |
| Re_ Pension Asset at PD&G tomorrow.pdf | 2018-10-25 13:11 | 21K | |
| Re_ Potential Rate Mitigation_1.pdf | 2018-10-25 13:11 | 44K | |
| Re_ Public Account Description.pdf | 2018-10-25 13:11 | 29K | |
| Re_ Release of 2015 - 2016 Financial Statements (Unaudited).pdf | 2018-10-25 13:11 | 52K | |
| Re_ Speaking Notes.pdf | 2018-10-25 13:11 | 59K | |
| Re_ The Fair Hydro Plan.pdf | 2018-10-25 13:11 | 33K | |
| Re_ URGENT Electricity Relief.pdf | 2018-10-25 13:11 | 18K | |
| Records Retention - Memorandum from Andrew Bevan Oct. 24, 2017.pdf | 2018-10-25 13:11 | 40K | |
| Regulated Price Plan Materials.pdf | 2018-10-25 13:11 | 20K | |
| Reminder_ Independent Accounting Experts Release Report_2.pdf | 2018-10-25 13:11 | 40K | |
| Response to Letter on AG Request for Documents.pdf | 2018-10-25 13:11 | 30K | |
| Revised letters.pdf | 2018-10-25 13:11 | 24K | |
| SFR Major Projects Deck May 10 6pm.pptx.pdf | 2018-10-25 13:11 | 264K | |
| SOC Debt Presentation June 4 2018.pptx.pdf | 2018-10-25 13:11 | 26K | |
| SOC Debt Presentation June 4 2018.pptx_1.pdf | 2018-10-25 13:11 | 605K | |
| SOC briefing accounting risks_Dec 8 pm.pptx.pdf | 2018-10-25 13:11 | 216K | |
| SOC slides_updated for FES 2017.pptx.pdf | 2018-10-25 13:11 | 134K | |
| SOC slides_updated for FES 2017.pptx_1.pdf | 2018-10-25 13:11 | 134K | |
| Scalable Initiatives_Feb 17 2017-6pm-Buys-NotBuys.pptx_5.pdf | 2018-10-25 13:11 | 198K | |
| Scalable Initiatives_Feb 17 2017-6pm-Buys-NotBuys.pptx_10.pdf | 2018-10-25 13:12 | 195K | |
| Sector Overviews.pdf | 2018-10-25 13:11 | 25K | |
| Small Biz_Decision Deck v19.pptx_3.pdf | 2018-10-25 13:11 | 372K | |
| Small Biz_Decision Deck v19.pptx_4.pdf | 2018-10-25 13:11 | 372K | |
| SoC Comms Products for University of Waterloo visit (Nov. 24).pdf | 2018-10-25 13:11 | 36K | |
| SoC briefing accounting risks_Nov 15.pptx_1.pdf | 2018-10-25 13:11 | 238K | |
| Sponsor Plan Expansion Proposal.docx.pdf | 2018-10-25 13:11 | 173K | |
| Statement from Minister Thibeault on the Ontario Energy Board's New Regulated Price Plan Electricity Rate Announcement_2.pdf | 2018-10-25 13:11 | 46K | |
| Statement from Minister of Energy on Hydro One Acquisition_3.pdf | 2018-10-25 13:11 | 46K | |
| Statement from the Minister of Energy on the Ontario Energy Board's New Regulated Price Plan (RPP) Electricity Rate Announcement_1.pdf | 2018-10-25 13:11 | 44K | |
| Statement from the President of the Treasury Board on the Auditor General's Annual Report_2.pdf | 2018-10-25 13:11 | 50K | |
| Supplemental Report from Panel.pdf | 2018-10-25 13:11 | 12K | |
| Support for business_sy_v4 om rm om bb (2).docx_2.pdf | 2018-10-25 13:11 | 118K | |
| Support for business_sy_v4 om rm om bb (2).docx_3.pdf | 2018-10-25 13:11 | 118K | |
| TAB 1_ Call with DM Imbrogno.pdf | 2018-10-25 13:11 | 42K | |
| TAB 1_ Call with Steve Orsini and Gottfried Boehringer.pdf | 2018-10-25 13:11 | 16K | |
| TAB 2; Caretaker Committee.pdf | 2018-10-25 13:11 | 19K | |
| TAB 2_ Fiscal Prep Committee.pdf | 2018-10-25 13:11 | 18K | |
| TAB 2_ MMMP e-Binder.pdf | 2018-10-25 13:11 | 19K | |
| TAB 2_ Meeting re_ Hydro Quebec Agreements _ Steve Orsini, David Butters, Serge Imbrogno.pdf | 2018-10-25 13:11 | 36K | |
| TAB 2_ Monthly Accounting Risks.pdf | 2018-10-25 13:11 | 18K | |
| TAB 2_ Pre-Briefing_ Rate Framework Roll-Out Plan.pdf | 2018-10-25 13:11 | 12K | |
| TAB 2_ Toronto Board of Trade Infrastruture Roundtable.pdf | 2018-10-25 13:11 | 26K | |
| TAB 3_ Accounting Risks Briefing l SoC, Helen Angus, Cindy Veinot, Karen Hughes, Steven Davidson, William Bromm, Boafoa Kwamena, Scott Thompson.pdf | 2018-10-25 13:11 | 25K | |
| TAB 3_ Bi-weekly Accounting Risks Briefing.pdf | 2018-10-25 13:11 | 12K | |
| TAB 3_ Major Projects Meeting.pdf | 2018-10-25 13:11 | 16K | |
| TAB 4_ MMMP e-copies.pdf | 2018-10-25 13:11 | 17K | |
| TAB 4_ Mtg. with Hugh O'Reilly and Tim Shortill.pdf | 2018-10-25 13:11 | 19K | |
| TAB 4_ Mtg re_ Hydro Quebec and LTEP.pdf | 2018-10-25 13:11 | 18K | |
| TAB 5_ Long-Term Energy Plan Multi-Ministry Meeting.pdf | 2018-10-25 13:11 | 29K | |
| TAB 5_ Weekly Meeting with Steve Orsini, Steven Davidson, Lynn Betzner, Andrew Bevan, Gillian McEachern, William Bromm, Mary Rowe, Mike Jancik.pdf | 2018-10-25 13:11 | 18K | |
| TAB 5_ Weekly Meeting with Steve Orsini, Steven Davidson, Lynn Betzner, Andrew Bevan, Gillian McEachern, William Bromm, Mary Rowe, Mike Jancik_1.pdf | 2018-10-25 13:11 | 18K | |
| TAB 6_ FYI_ Multi-Minister Meeting _ Ontario Fair Hydro Plan Implementation (Ministers Thibeault, Matthews, Sousa, Sandals).pdf | 2018-10-25 13:11 | 32K | |
| TAB 6_ LTEP_ Ontario Fair Hydro Plan Reconciliation - __Pls Note Time and Location Change__ LUNCH WILL BE PROVIDED.pdf | 2018-10-25 13:11 | 23K | |
| TAB 6_ LTEP_ Ontario Fair Hydro Plan Reconciliation.pdf | 2018-10-25 13:11 | 17K | |
| TAB 7_ Fair Hydro Plan.pdf | 2018-10-25 13:11 | 12K | |
| TAB 7_ Fair Hydro Plan _ Secretary Orsini, Cindy Veinot, Karen Hughes, William Bromm, Boafoa Kwamena.pdf | 2018-10-25 13:11 | 17K | |
| TAB 8_ Fair Hydro Plan Update.pdf | 2018-10-25 13:11 | 18K | |
| TAB 9_ Electricity Mitigation l Steve Orsini, Ed Clark, Serge Imbrogno, Scott Thompson, Gadi Mayman, Helen Angus, Karen Hughes.pdf | 2018-10-25 13:11 | 25K | |
| TAB 9_ MMP e-binder.pdf | 2018-10-25 13:11 | 18K | |
| TAB 9_ Meeting with the Premier.pdf | 2018-10-25 13:11 | 17K | |
| TAB 10_ Bi Weekly with Patrick Monahan.pdf | 2018-10-25 13:11 | 12K | |
| TAB 10_ Continuation of Electricity Mitigation Meeting l Steve Orsini, Serge Imbrogno, Scott Thompson, Gadi Mayman, Helen Angus, Karen Hughes.pdf | 2018-10-25 13:11 | 17K | |
| TAB 10_ FAO Report on OFHP.pdf | 2018-10-25 13:11 | 22K | |
| TAB 11_ College Presidents Retreat.pdf | 2018-10-25 13:11 | 20K | |
| TBS Expense_Feb 8 2017_530pm (2).pptx.pdf | 2018-10-25 13:11 | 220K | |
| Updates to Provincial Regulations Create a Fairer, Better Ontario_1.pdf | 2018-10-25 13:11 | 50K | |
| Velshi, Alykhan - AG Special Report on Fair Hydro Plan - October 20, 2017.docx.pdf | 2018-10-25 13:11 | 79K | |
| Velshi, Alykhan - AG Special Report on Fair Hydro Plan - October 20, 2017.docx_1.pdf | 2018-10-25 13:11 | 79K | |
| Watchdog Wednesday_ Your Afternoon QP Briefing.pdf | 2018-10-25 13:11 | 42K | |
| World Bank Canadian case study - update for Ontario SoC.PDF.pdf | 2018-10-25 13:11 | 659K | |
| World Bank Canadian case study - update for Ontario SoC.PDF_1.pdf | 2018-10-25 13:11 | 659K | |
| Year-End Memo.pdf | 2018-10-25 13:11 | 16K | |
| [Insert duck pun here]_ Your Morning QP Briefing_1.pdf | 2018-10-25 13:11 | 43K | |
| [No Subject]_20.pdf | 2018-10-25 13:11 | 44K | |
| [No Subject]_21.pdf | 2018-10-25 13:11 | 28K | |
| [Unnamed Calendar Entry]_1.pdf | 2018-10-25 13:11 | 15K | |
| coalition energy improvements_2.pdf | 2018-10-25 13:11 | 2.1M | |
| formal submission LTEP Dec 14 - updated 0317.pdf | 2018-10-25 13:11 | 262K | |
| materials_ Energy Meeting with Premier & Minister.pdf | 2018-10-25 13:11 | 32K | |
| my new electricity policy report.pdf | 2018-10-25 13:11 | 18K | |
| one pager.pdf | 2018-10-25 13:11 | 26K | |
| pension-asset-expert-advisory-panel-submits-report.doc.pdf | 2018-10-25 13:12 | 2.1K | |
| price mitigation minute draft Feb 18-SoC.docx.pdf | 2018-10-25 13:11 | 46K | |
| price mitigation minute draft Feb 18-SoC.pdf | 2018-10-25 13:11 | 19K | |
| price mitigation minute draft Feb 18.docx_1.pdf | 2018-10-25 13:11 | 36K | |
| price mitigation minute draft Feb 24 330pm.docx_3.pdf | 2018-10-25 13:12 | 55K | |
| price mitigation minute draft Feb 25 10pm.docx_2.pdf | 2018-10-25 13:11 | 55K | |
| price mitigation minute draft Feb 25 10pm.docx_3.pdf | 2018-10-25 13:11 | 55K | |
| price mitigation minute draft Feb 27 330pm.docx_3.pdf | 2018-10-25 13:11 | 78K | |
|
|---|